1-Benzylpiperazine-2-one HCl
1-Benzylpiperazin-2-one
CAS: 59702-21-5
Molecular Formula: C11H14N2O
1-Benzylpiperazine-2-one HCl - Names and Identifiers
| Name | 1-Benzylpiperazin-2-one |
| Synonyms | 1-Benzyl-2-piperazinone 1-Benzylpiperazin-2-one 1-Benzyl-2-oxopiperazine 1-BENZYLPIPERAZINE-2-ONE 1-BENZYL-PIPERAZIN-2-ONE 1-Benzylpiperazine-2-one HCl 1-(Phenylmethyl)-2-piperazinone 2-Piperazinone, 1-(phenylmethyl)- 1-Benzylpiperazine-2-one hydrochloride |
| CAS | 59702-21-5 |
| InChI | InChI=1/C11H14N2O/c14-11-8-12-6-7-13(11)9-10-4-2-1-3-5-10/h1-5,12H,6-9H2 |
1-Benzylpiperazine-2-one HCl - Physico-chemical Properties
| Molecular Formula | C11H14N2O |
| Molar Mass | 190.24 |
| Density | 1.130 |
| Boling Point | 380.4±42.0 °C(Predicted) |
| Flash Point | 183.9°C |
| Vapor Presure | 5.47E-06mmHg at 25°C |
| pKa | 7.67±0.20(Predicted) |
| Refractive Index | 1.562 |
1-Benzylpiperazine-2-one HCl - Reference Information
| use | 1-benzyl-2-oxopiperazine can be used as an intermediate in pharmaceutical synthesis. |
Last Update：2024-04-10 22:29:15
